About (E,3S)-1-(benzenesulfinyl)-2-bromo-4,4-dimethylpent-1-en-3-ol
(E,3S)-1-(benzenesulfinyl)-2-bromo-4,4-dimethylpent-1-en-3-ol (PubChem CID 101242295) has the molecular formula C13H17BrO2S
and a molecular weight of 317.25 g/mol. Its IUPAC name is (E,3S)-1-(benzenesulfinyl)-2-bromo-4,4-dimethylpent-1-en-3-ol.
Molecular Properties
| Compound Name | (E,3S)-1-(benzenesulfinyl)-2-bromo-4,4-dimethylpent-1-en-3-ol |
| PubChem CID | 101242295 |
| Molecular Formula | C13H17BrO2S |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | (E,3S)-1-(benzenesulfinyl)-2-bromo-4,4-dimethylpent-1-en-3-ol |
| SMILES | CC(C)(C)[C@H](O)/C(Br)=C\S(=O)c1ccccc1 |
| InChI | InChI=1S/C13H17BrO2S/c1-13(2,3)12(15)11(14)9-17(16)10-7-5-4-6-8-10/h4-9,12,15H,1-3H3/b11-9+/t12-,17?/m1/s1 |
| InChIKey | GVHUVMIETKOGOJ-YJRMDLGISA-N |
| XLogP | 3.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (E,3S)-1-(benzenesulfinyl)-2-bromo-4,4-dimethylpent-1-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,3S)-1-(benzenesulfinyl)-2-bromo-4,4-dimethylpent-1-en-3-ol?
The IUPAC name of (E,3S)-1-(benzenesulfinyl)-2-bromo-4,4-dimethylpent-1-en-3-ol (CID 101242295) is (E,3S)-1-(benzenesulfinyl)-2-bromo-4,4-dimethylpent-1-en-3-ol.
What is the SMILES notation for (E,3S)-1-(benzenesulfinyl)-2-bromo-4,4-dimethylpent-1-en-3-ol?
The canonical SMILES for (E,3S)-1-(benzenesulfinyl)-2-bromo-4,4-dimethylpent-1-en-3-ol is CC(C)(C)[C@H](O)/C(Br)=C\S(=O)c1ccccc1.
What is the InChIKey of (E,3S)-1-(benzenesulfinyl)-2-bromo-4,4-dimethylpent-1-en-3-ol?
The InChIKey is GVHUVMIETKOGOJ-YJRMDLGISA-N. The full InChI is InChI=1S/C13H17BrO2S/c1-13(2,3)12(15)11(14)9-17(16)10-7-5-4-6-8-10/h4-9,12,15H,1-3H3/b11-9+/t12-,17?/m1/s1.
What are the key properties of (E,3S)-1-(benzenesulfinyl)-2-bromo-4,4-dimethylpent-1-en-3-ol?
(E,3S)-1-(benzenesulfinyl)-2-bromo-4,4-dimethylpent-1-en-3-ol has a molecular weight of 317.25 g/mol, XLogP of 3.44, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E,3S)-1-(benzenesulfinyl)-2-bromo-4,4-dimethylpent-1-en-3-ol is sourced from PubChem (CID 101242295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).