C10H14N2 — CID 101243046
(4S,9aR)-4,6,7,8,9,9a-hexahydro-3H-quinolizine-4-carbonitrile (PubChem CID 101243046) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is (4S,9aR)-4,6,7,8,9,9a-hexahydro-3H-quinolizine-4-carbonitrile.
| Compound Name | (4S,9aR)-4,6,7,8,9,9a-hexahydro-3H-quinolizine-4-carbonitrile |
|---|---|
| PubChem CID | 101243046 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | (4S,9aR)-4,6,7,8,9,9a-hexahydro-3H-quinolizine-4-carbonitrile |
| SMILES | N#C[C@@H]1CC=C[C@H]2CCCCN12 |
| InChI | InChI=1S/C10H14N2/c11-8-10-6-3-5-9-4-1-2-7-12(9)10/h3,5,9-10H,1-2,4,6-7H2/t9-,10+/m1/s1 |
| InChIKey | GLMIFPCOXGYSQA-ZJUUUORDSA-N |
| XLogP | 1.69 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|