C9H9BrO2 — CID 101243117
(1S,2R)-6-bromo-2,3-dihydro-1H-indene-1,2-diol (PubChem CID 101243117) has the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. Its IUPAC name is (1S,2R)-6-bromo-2,3-dihydro-1H-indene-1,2-diol.
| Compound Name | (1S,2R)-6-bromo-2,3-dihydro-1H-indene-1,2-diol |
|---|---|
| PubChem CID | 101243117 |
| Molecular Formula | C9H9BrO2 |
| Molecular Weight | 229.07 g/mol |
| Exact Mass | 227.98 |
| IUPAC Name | (1S,2R)-6-bromo-2,3-dihydro-1H-indene-1,2-diol |
| SMILES | O[C@@H]1Cc2ccc(Br)cc2[C@@H]1O |
| InChI | InChI=1S/C9H9BrO2/c10-6-2-1-5-3-8(11)9(12)7(5)4-6/h1-2,4,8-9,11-12H,3H2/t8-,9+/m1/s1 |
| InChIKey | HUSIJTCSGAHUQN-BDAKNGLRSA-N |
| XLogP | 1.40 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.07 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |