C20H30O5 — CID 101243404
ethyl (3aR,8aR,9R,9aS)-5-hydroxy-2,2,8a-trimethyl-9-propan-2-yl-7,8,9,9a-tetrahydro-3aH-azuleno[1,2-d][1,3]dioxole-6-carboxylate (PubChem CID 101243404) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is ethyl (3aR,8aR,9R,9aS)-5-hydroxy-2,2,8a-trimethyl-9-propan-2-yl-7,8,9,9a-tetrahydro-3aH-azuleno[1,2-d][1,3]dioxole-6-carboxylate.
| Compound Name | ethyl (3aR,8aR,9R,9aS)-5-hydroxy-2,2,8a-trimethyl-9-propan-2-yl-7,8,9,9a-tetrahydro-3aH-azuleno[1,2-d][1,3]dioxole-6-carboxylate |
|---|---|
| PubChem CID | 101243404 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | ethyl (3aR,8aR,9R,9aS)-5-hydroxy-2,2,8a-trimethyl-9-propan-2-yl-7,8,9,9a-tetrahydro-3aH-azuleno[1,2-d][1,3]dioxole-6-carboxylate |
| SMILES | CCOC(=O)C1=C(O)C=C2[C@H]3OC(C)(C)O[C@H]3[C@H](C(C)C)[C@@]2(C)CC1 |
| InChI | InChI=1S/C20H30O5/c1-7-23-18(22)12-8-9-20(6)13(10-14(12)21)16-17(15(20)11(2)3)25-19(4,5)24-16/h10-11,15-17,21H,7-9H2,1-6H3/t15-,16+,17-,20-/m0/s1 |
| InChIKey | BKTOGYZYOLYBLU-CLWJZODNSA-N |
| XLogP | 3.89 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |