C23H34O5 — CID 101243406
ethyl (3aR,6R,8aR,9R,9aS)-2,2,8a-trimethyl-5-oxo-9-propan-2-yl-6-prop-2-enyl-7,8,9,9a-tetrahydro-3aH-azuleno[1,2-d][1,3]dioxole-6-carboxylate (PubChem CID 101243406) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is ethyl (3aR,6R,8aR,9R,9aS)-2,2,8a-trimethyl-5-oxo-9-propan-2-yl-6-prop-2-enyl-7,8,9,9a-tetrahydro-3aH-azuleno[1,2-d][1,3]dioxole-6-carboxylate.
| Compound Name | ethyl (3aR,6R,8aR,9R,9aS)-2,2,8a-trimethyl-5-oxo-9-propan-2-yl-6-prop-2-enyl-7,8,9,9a-tetrahydro-3aH-azuleno[1,2-d][1,3]dioxole-6-carboxylate |
|---|---|
| PubChem CID | 101243406 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | ethyl (3aR,6R,8aR,9R,9aS)-2,2,8a-trimethyl-5-oxo-9-propan-2-yl-6-prop-2-enyl-7,8,9,9a-tetrahydro-3aH-azuleno[1,2-d][1,3]dioxole-6-carboxylate |
| SMILES | C=CC[C@]1(C(=O)OCC)CC[C@@]2(C)C(=CC1=O)[C@H]1OC(C)(C)O[C@H]1[C@@H]2C(C)C |
| InChI | InChI=1S/C23H34O5/c1-8-10-23(20(25)26-9-2)12-11-22(7)15(13-16(23)24)18-19(17(22)14(3)4)28-21(5,6)27-18/h8,13-14,17-19H,1,9-12H2,2-7H3/t17-,18+,19-,22-,23-/m0/s1 |
| InChIKey | NPDOONKJYIKDOC-GCAMRICFSA-N |
| XLogP | 4.21 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|