C25H38O5 — CID 101243408
ethyl (3S,4R,8R,11R,12R,13S,17R)-3-hydroxy-4,11,15,15-tetramethyl-12-propan-2-yl-14,16-dioxatetracyclo[9.6.0.03,8.013,17]heptadeca-1,5-diene-8-carboxylate (PubChem CID 101243408) has the molecular formula C25H38O5 and a molecular weight of 418.57 g/mol. Its IUPAC name is ethyl (3S,4R,8R,11R,12R,13S,17R)-3-hydroxy-4,11,15,15-tetramethyl-12-propan-2-yl-14,16-dioxatetracyclo[9.6.0.03,8.013,17]heptadeca-1,5-diene-8-carboxylate.
| Compound Name | ethyl (3S,4R,8R,11R,12R,13S,17R)-3-hydroxy-4,11,15,15-tetramethyl-12-propan-2-yl-14,16-dioxatetracyclo[9.6.0.03,8.013,17]heptadeca-1,5-diene-8-carboxylate |
|---|---|
| PubChem CID | 101243408 |
| Molecular Formula | C25H38O5 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | ethyl (3S,4R,8R,11R,12R,13S,17R)-3-hydroxy-4,11,15,15-tetramethyl-12-propan-2-yl-14,16-dioxatetracyclo[9.6.0.03,8.013,17]heptadeca-1,5-diene-8-carboxylate |
| SMILES | CCOC(=O)[C@]12CC=C[C@@H](C)[C@]1(O)C=C1[C@H]3OC(C)(C)O[C@H]3[C@H](C(C)C)[C@@]1(C)CC2 |
| InChI | InChI=1S/C25H38O5/c1-8-28-21(26)24-11-9-10-16(4)25(24,27)14-17-19-20(30-22(5,6)29-19)18(15(2)3)23(17,7)12-13-24/h9-10,14-16,18-20,27H,8,11-13H2,1-7H3/t16-,18+,19-,20+,23+,24-,25-/m1/s1 |
| InChIKey | HAILHHPUHSJWRR-PGFWSEEESA-N |
| XLogP | 4.40 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|