C17H28O6Si2 — CID 101243648
(2S,6R)-10-[dimethyl(3-trimethoxysilylpropyl)silyl]-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 101243648) has the molecular formula C17H28O6Si2 and a molecular weight of 384.58 g/mol. Its IUPAC name is (2S,6R)-10-[dimethyl(3-trimethoxysilylpropyl)silyl]-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (2S,6R)-10-[dimethyl(3-trimethoxysilylpropyl)silyl]-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 101243648 |
| Molecular Formula | C17H28O6Si2 |
| Molecular Weight | 384.58 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | (2S,6R)-10-[dimethyl(3-trimethoxysilylpropyl)silyl]-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CO[Si](CCC[Si](C)(C)C1C2C=CC1[C@@H]1C(=O)OC(=O)[C@H]21)(OC)OC |
| InChI | InChI=1S/C17H28O6Si2/c1-20-25(21-2,22-3)10-6-9-24(4,5)15-11-7-8-12(15)14-13(11)16(18)23-17(14)19/h7-8,11-15H,6,9-10H2,1-5H3/t11?,12?,13-,14+,15? |
| InChIKey | DUMJAGULXDSFMS-QRFUTXMCSA-N |
| XLogP | 2.46 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.58 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|