C22H24O — CID 101243651
(4aR,10aR)-4,4-dimethyl-9-phenyl-2,3,4a,9,10,10a-hexahydrophenanthren-1-one (PubChem CID 101243651) has the molecular formula C22H24O and a molecular weight of 304.43 g/mol. Its IUPAC name is (4aR,10aR)-4,4-dimethyl-9-phenyl-2,3,4a,9,10,10a-hexahydrophenanthren-1-one.
| Compound Name | (4aR,10aR)-4,4-dimethyl-9-phenyl-2,3,4a,9,10,10a-hexahydrophenanthren-1-one |
|---|---|
| PubChem CID | 101243651 |
| Molecular Formula | C22H24O |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | (4aR,10aR)-4,4-dimethyl-9-phenyl-2,3,4a,9,10,10a-hexahydrophenanthren-1-one |
| SMILES | CC1(C)CCC(=O)[C@@H]2CC(c3ccccc3)c3ccccc3[C@H]21 |
| InChI | InChI=1S/C22H24O/c1-22(2)13-12-20(23)19-14-18(15-8-4-3-5-9-15)16-10-6-7-11-17(16)21(19)22/h3-11,18-19,21H,12-14H2,1-2H3/t18?,19-,21+/m0/s1 |
| InChIKey | YAPRMRNPXFNUCZ-IZOREMLJSA-N |
| XLogP | 5.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |