C51H42O6 — CID 101243710
[4-[[3,5-bis[(4-benzoylphenoxy)methyl]-2,4,6-trimethylphenyl]methoxy]phenyl]-phenylmethanone (PubChem CID 101243710) has the molecular formula C51H42O6 and a molecular weight of 750.89 g/mol. Its IUPAC name is [4-[[3,5-bis[(4-benzoylphenoxy)methyl]-2,4,6-trimethylphenyl]methoxy]phenyl]-phenylmethanone.
| Compound Name | [4-[[3,5-bis[(4-benzoylphenoxy)methyl]-2,4,6-trimethylphenyl]methoxy]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 101243710 |
| Molecular Formula | C51H42O6 |
| Molecular Weight | 750.89 g/mol |
| Exact Mass | 750.30 |
| IUPAC Name | [4-[[3,5-bis[(4-benzoylphenoxy)methyl]-2,4,6-trimethylphenyl]methoxy]phenyl]-phenylmethanone |
| SMILES | Cc1c(COc2ccc(C(=O)c3ccccc3)cc2)c(C)c(COc2ccc(C(=O)c3ccccc3)cc2)c(C)c1COc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C51H42O6/c1-34-46(31-55-43-25-19-40(20-26-43)49(52)37-13-7-4-8-14-37)35(2)48(33-57-45-29-23-42(24-30-45)51(54)39-17-11-6-12-18-39)36(3)47(34)32-56-44-27-21-41(22-28-44)50(53)38-15-9-5-10-16-38/h4-30H,31-33H2,1-3H3 |
| InChIKey | NNHSXQCYSPHHJX-UHFFFAOYSA-N |
| XLogP | 11.04 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.89 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |