C23H24N2O4 — CID 101244056
1-O-benzyl 2-O-[2-(1H-indol-3-yl)ethyl] (2S)-pyrrolidine-1,2-dicarboxylate (PubChem CID 101244056) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is 1-O-benzyl 2-O-[2-(1H-indol-3-yl)ethyl] (2S)-pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-[2-(1H-indol-3-yl)ethyl] (2S)-pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 101244056 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 1-O-benzyl 2-O-[2-(1H-indol-3-yl)ethyl] (2S)-pyrrolidine-1,2-dicarboxylate |
| SMILES | O=C(OCCc1c[nH]c2ccccc12)[C@@H]1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H24N2O4/c26-22(28-14-12-18-15-24-20-10-5-4-9-19(18)20)21-11-6-13-25(21)23(27)29-16-17-7-2-1-3-8-17/h1-5,7-10,15,21,24H,6,11-14,16H2/t21-/m0/s1 |
| InChIKey | KZNBNRHZRPZVRX-NRFANRHFSA-N |
| XLogP | 4.05 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |