C20H15NO — CID 101244278
(E)-4-(11-azatetracyclo[8.7.0.02,8.012,17]heptadeca-1,3,5,7,9,12,14,16-octaen-9-yl)but-3-en-2-one (PubChem CID 101244278) has the molecular formula C20H15NO and a molecular weight of 285.35 g/mol. Its IUPAC name is (E)-4-(11-azatetracyclo[8.7.0.02,8.012,17]heptadeca-1,3,5,7,9,12,14,16-octaen-9-yl)but-3-en-2-one.
| Compound Name | (E)-4-(11-azatetracyclo[8.7.0.02,8.012,17]heptadeca-1,3,5,7,9,12,14,16-octaen-9-yl)but-3-en-2-one |
|---|---|
| PubChem CID | 101244278 |
| Molecular Formula | C20H15NO |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | (E)-4-(11-azatetracyclo[8.7.0.02,8.012,17]heptadeca-1,3,5,7,9,12,14,16-octaen-9-yl)but-3-en-2-one |
| SMILES | CC(=O)/C=C/c1c2cccccc-2c2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C20H15NO/c1-13(22)11-12-16-14-7-3-2-4-8-15(14)19-17-9-5-6-10-18(17)21-20(16)19/h2-12,21H,1H3/b12-11+ |
| InChIKey | TUNIWZFLCZBBQG-VAWYXSNFSA-N |
| XLogP | 5.03 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|