C26H42OS — CID 101244321
2,2-dimethyl-3-[(3E,7E,11E,15E,17Z)-3,7,12-trimethyl-18-methylsulfanyloctadeca-3,7,11,15,17-pentaenyl]oxirane (PubChem CID 101244321) has the molecular formula C26H42OS and a molecular weight of 402.69 g/mol. Its IUPAC name is 2,2-dimethyl-3-[(3E,7E,11E,15E,17Z)-3,7,12-trimethyl-18-methylsulfanyloctadeca-3,7,11,15,17-pentaenyl]oxirane.
| Compound Name | 2,2-dimethyl-3-[(3E,7E,11E,15E,17Z)-3,7,12-trimethyl-18-methylsulfanyloctadeca-3,7,11,15,17-pentaenyl]oxirane |
|---|---|
| PubChem CID | 101244321 |
| Molecular Formula | C26H42OS |
| Molecular Weight | 402.69 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | 2,2-dimethyl-3-[(3E,7E,11E,15E,17Z)-3,7,12-trimethyl-18-methylsulfanyloctadeca-3,7,11,15,17-pentaenyl]oxirane |
| SMILES | CS/C=C\C=C\CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC1OC1(C)C |
| InChI | InChI=1S/C26H42OS/c1-22(14-9-7-8-12-21-28-6)15-10-11-16-23(2)17-13-18-24(3)19-20-25-26(4,5)27-25/h7-8,12,15-16,18,21,25H,9-11,13-14,17,19-20H2,1-6H3/b8-7+,21-12-,22-15+,23-16+,24-18+ |
| InChIKey | LOHIVYZBJLSKDE-QJNKVVPGSA-N |
| XLogP | 8.56 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.69 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|