C25H52O5Si2 — CID 101244412
(2R,3R,4S)-2-[tert-butyl(dimethyl)silyl]oxy-4-(1,3-dioxolan-2-yl)-5-methyl-1-tri(propan-2-yl)silyloxyhex-5-en-3-ol (PubChem CID 101244412) has the molecular formula C25H52O5Si2 and a molecular weight of 488.86 g/mol. Its IUPAC name is (2R,3R,4S)-2-[tert-butyl(dimethyl)silyl]oxy-4-(1,3-dioxolan-2-yl)-5-methyl-1-tri(propan-2-yl)silyloxyhex-5-en-3-ol.
| Compound Name | (2R,3R,4S)-2-[tert-butyl(dimethyl)silyl]oxy-4-(1,3-dioxolan-2-yl)-5-methyl-1-tri(propan-2-yl)silyloxyhex-5-en-3-ol |
|---|---|
| PubChem CID | 101244412 |
| Molecular Formula | C25H52O5Si2 |
| Molecular Weight | 488.86 g/mol |
| Exact Mass | 488.34 |
| IUPAC Name | (2R,3R,4S)-2-[tert-butyl(dimethyl)silyl]oxy-4-(1,3-dioxolan-2-yl)-5-methyl-1-tri(propan-2-yl)silyloxyhex-5-en-3-ol |
| SMILES | C=C(C)[C@H](C1OCCO1)[C@@H](O)[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H52O5Si2/c1-17(2)22(24-27-14-15-28-24)23(26)21(30-31(12,13)25(9,10)11)16-29-32(18(3)4,19(5)6)20(7)8/h18-24,26H,1,14-16H2,2-13H3/t21-,22+,23+/m1/s1 |
| InChIKey | YZOPUFGAZDAZNH-VJBWXMMDSA-N |
| XLogP | 6.49 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.86 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|