C29H60O4Si2 — CID 101244418
(E)-1-[(2S,3S)-3-[(1R)-1,2-bis[tri(propan-2-yl)silyloxy]ethyl]-2-methyloxiran-2-yl]-2-methylpent-2-en-1-ol (PubChem CID 101244418) has the molecular formula C29H60O4Si2 and a molecular weight of 528.97 g/mol. Its IUPAC name is (E)-1-[(2S,3S)-3-[(1R)-1,2-bis[tri(propan-2-yl)silyloxy]ethyl]-2-methyloxiran-2-yl]-2-methylpent-2-en-1-ol.
| Compound Name | (E)-1-[(2S,3S)-3-[(1R)-1,2-bis[tri(propan-2-yl)silyloxy]ethyl]-2-methyloxiran-2-yl]-2-methylpent-2-en-1-ol |
|---|---|
| PubChem CID | 101244418 |
| Molecular Formula | C29H60O4Si2 |
| Molecular Weight | 528.97 g/mol |
| Exact Mass | 528.40 |
| IUPAC Name | (E)-1-[(2S,3S)-3-[(1R)-1,2-bis[tri(propan-2-yl)silyloxy]ethyl]-2-methyloxiran-2-yl]-2-methylpent-2-en-1-ol |
| SMILES | CC/C=C(\C)C(O)[C@]1(C)O[C@H]1[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H60O4Si2/c1-16-17-25(14)27(30)29(15)28(32-29)26(33-35(22(8)9,23(10)11)24(12)13)18-31-34(19(2)3,20(4)5)21(6)7/h17,19-24,26-28,30H,16,18H2,1-15H3/b25-17+/t26-,27?,28+,29+/m1/s1 |
| InChIKey | SRUVFZUKLWKCOW-QJJRGQCDSA-N |
| XLogP | 8.61 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.97 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|