C7H9NO3 — CID 101244582
(6-oxo-2,3-dihydro-1H-pyridin-3-yl) acetate (PubChem CID 101244582) has the molecular formula C7H9NO3 and a molecular weight of 155.15 g/mol. Its IUPAC name is (6-oxo-2,3-dihydro-1H-pyridin-3-yl) acetate.
| Compound Name | (6-oxo-2,3-dihydro-1H-pyridin-3-yl) acetate |
|---|---|
| PubChem CID | 101244582 |
| Molecular Formula | C7H9NO3 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | (6-oxo-2,3-dihydro-1H-pyridin-3-yl) acetate |
| SMILES | CC(=O)OC1C=CC(=O)NC1 |
| InChI | InChI=1S/C7H9NO3/c1-5(9)11-6-2-3-7(10)8-4-6/h2-3,6H,4H2,1H3,(H,8,10) |
| InChIKey | HJRCUTSOYNTHOM-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |