C15H7F5O2 — CID 101245018
(2,3,4,5,6-pentafluorophenyl) 3,6-dimethylidenecyclohexa-1,4-diene-1-carboxylate (PubChem CID 101245018) has the molecular formula C15H7F5O2 and a molecular weight of 314.21 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 3,6-dimethylidenecyclohexa-1,4-diene-1-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 3,6-dimethylidenecyclohexa-1,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 101245018 |
| Molecular Formula | C15H7F5O2 |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 3,6-dimethylidenecyclohexa-1,4-diene-1-carboxylate |
| SMILES | C=c1ccc(=C)c(C(=O)Oc2c(F)c(F)c(F)c(F)c2F)c1 |
| InChI | InChI=1S/C15H7F5O2/c1-6-3-4-7(2)8(5-6)15(21)22-14-12(19)10(17)9(16)11(18)13(14)20/h3-5H,1-2H2 |
| InChIKey | JSIGYOXEOPFUKJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|