C7HF14N — CID 101245741
2,2,3,3,4,4,5,5-octafluoro-1-(1,1,2,3,3,3-hexafluoropropyl)pyrrolidine (PubChem CID 101245741) has the molecular formula C7HF14N and a molecular weight of 365.06 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoro-1-(1,1,2,3,3,3-hexafluoropropyl)pyrrolidine.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoro-1-(1,1,2,3,3,3-hexafluoropropyl)pyrrolidine |
|---|---|
| PubChem CID | 101245741 |
| Molecular Formula | C7HF14N |
| Molecular Weight | 365.06 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoro-1-(1,1,2,3,3,3-hexafluoropropyl)pyrrolidine |
| SMILES | FC(C(F)(F)F)C(F)(F)N1C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C7HF14N/c8-1(2(9,10)11)3(12,13)22-6(18,19)4(14,15)5(16,17)7(22,20)21/h1H |
| InChIKey | MGYIPDWCTCRMPW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.06 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|