C42H68Br2 — CID 101246541
2-bromo-1-[11-(2-bromo-3,5-ditert-butylphenyl)-2,11-dimethyldodecan-2-yl]-3,5-ditert-butylbenzene (PubChem CID 101246541) has the molecular formula C42H68Br2 and a molecular weight of 732.81 g/mol. Its IUPAC name is 2-bromo-1-[11-(2-bromo-3,5-ditert-butylphenyl)-2,11-dimethyldodecan-2-yl]-3,5-ditert-butylbenzene.
| Compound Name | 2-bromo-1-[11-(2-bromo-3,5-ditert-butylphenyl)-2,11-dimethyldodecan-2-yl]-3,5-ditert-butylbenzene |
|---|---|
| PubChem CID | 101246541 |
| Molecular Formula | C42H68Br2 |
| Molecular Weight | 732.81 g/mol |
| Exact Mass | 730.37 |
| IUPAC Name | 2-bromo-1-[11-(2-bromo-3,5-ditert-butylphenyl)-2,11-dimethyldodecan-2-yl]-3,5-ditert-butylbenzene |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(Br)c(C(C)(C)CCCCCCCCC(C)(C)c2cc(C(C)(C)C)cc(C(C)(C)C)c2Br)c1 |
| InChI | InChI=1S/C42H68Br2/c1-37(2,3)29-25-31(39(7,8)9)35(43)33(27-29)41(13,14)23-21-19-17-18-20-22-24-42(15,16)34-28-30(38(4,5)6)26-32(36(34)44)40(10,11)12/h25-28H,17-24H2,1-16H3 |
| InChIKey | VKCGQAZVFAKSRH-UHFFFAOYSA-N |
| XLogP | 14.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.81 |
| LogP ≤ 5 | 14.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|