C31H45NO6SSi2 — CID 101247340
2-[(6aR,8R,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-1-(benzenesulfonyl)indole (PubChem CID 101247340) has the molecular formula C31H45NO6SSi2 and a molecular weight of 615.94 g/mol. Its IUPAC name is 2-[(6aR,8R,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-1-(benzenesulfonyl)indole.
| Compound Name | 2-[(6aR,8R,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-1-(benzenesulfonyl)indole |
|---|---|
| PubChem CID | 101247340 |
| Molecular Formula | C31H45NO6SSi2 |
| Molecular Weight | 615.94 g/mol |
| Exact Mass | 615.25 |
| IUPAC Name | 2-[(6aR,8R,9aS)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-8-yl]-1-(benzenesulfonyl)indole |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2O[C@@H](c3cc4ccccc4n3S(=O)(=O)c3ccccc3)C[C@@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C31H45NO6SSi2/c1-21(2)40(22(3)4)35-20-31-30(37-41(38-40,23(5)6)24(7)8)19-29(36-31)28-18-25-14-12-13-17-27(25)32(28)39(33,34)26-15-10-9-11-16-26/h9-18,21-24,29-31H,19-20H2,1-8H3/t29-,30+,31-/m1/s1 |
| InChIKey | UVCBPISZCDPGHY-MJSOWUPRSA-N |
| XLogP | 7.66 |
| TPSA | 75.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.94 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|