C11H17NO5 — CID 101247533
(4aS,5S,6S,8aR)-4a,6-dihydroxy-8a-methyl-5-nitro-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one (PubChem CID 101247533) has the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. Its IUPAC name is (4aS,5S,6S,8aR)-4a,6-dihydroxy-8a-methyl-5-nitro-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one.
| Compound Name | (4aS,5S,6S,8aR)-4a,6-dihydroxy-8a-methyl-5-nitro-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 101247533 |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | (4aS,5S,6S,8aR)-4a,6-dihydroxy-8a-methyl-5-nitro-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one |
| SMILES | C[C@@]12CC[C@H](O)[C@H]([N+](=O)[O-])[C@]1(O)CCCC2=O |
| InChI | InChI=1S/C11H17NO5/c1-10-6-4-7(13)9(12(16)17)11(10,15)5-2-3-8(10)14/h7,9,13,15H,2-6H2,1H3/t7-,9-,10-,11+/m0/s1 |
| InChIKey | ZLHJUORDEPKQOI-DMLMCSCLSA-N |
| XLogP | 0.28 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|