C18H25NO6 — CID 101247678
(1R,2S,4R)-5-(5,5-dimethyl-1,3-dioxan-2-yl)-1,8,8-trimethoxy-7-oxobicyclo[2.2.2]oct-5-ene-2-carbonitrile (PubChem CID 101247678) has the molecular formula C18H25NO6 and a molecular weight of 351.40 g/mol. Its IUPAC name is (1R,2S,4R)-5-(5,5-dimethyl-1,3-dioxan-2-yl)-1,8,8-trimethoxy-7-oxobicyclo[2.2.2]oct-5-ene-2-carbonitrile.
| Compound Name | (1R,2S,4R)-5-(5,5-dimethyl-1,3-dioxan-2-yl)-1,8,8-trimethoxy-7-oxobicyclo[2.2.2]oct-5-ene-2-carbonitrile |
|---|---|
| PubChem CID | 101247678 |
| Molecular Formula | C18H25NO6 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | (1R,2S,4R)-5-(5,5-dimethyl-1,3-dioxan-2-yl)-1,8,8-trimethoxy-7-oxobicyclo[2.2.2]oct-5-ene-2-carbonitrile |
| SMILES | COC1(OC)C(=O)[C@@]2(OC)C=C(C3OCC(C)(C)CO3)[C@H]1C[C@H]2C#N |
| InChI | InChI=1S/C18H25NO6/c1-16(2)9-24-14(25-10-16)12-7-17(21-3)11(8-19)6-13(12)18(22-4,23-5)15(17)20/h7,11,13-14H,6,9-10H2,1-5H3/t11-,13+,17+/m0/s1 |
| InChIKey | LPOVBRIMSRLTQJ-XTQGRXLLSA-N |
| XLogP | 1.43 |
| TPSA | 87.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|