C17H23NO5 — CID 101247684
(1R,2R,4S)-5-(5,5-dimethyl-1,3-dioxan-2-yl)-8,8-dimethoxy-7-oxobicyclo[2.2.2]oct-5-ene-2-carbonitrile (PubChem CID 101247684) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is (1R,2R,4S)-5-(5,5-dimethyl-1,3-dioxan-2-yl)-8,8-dimethoxy-7-oxobicyclo[2.2.2]oct-5-ene-2-carbonitrile.
| Compound Name | (1R,2R,4S)-5-(5,5-dimethyl-1,3-dioxan-2-yl)-8,8-dimethoxy-7-oxobicyclo[2.2.2]oct-5-ene-2-carbonitrile |
|---|---|
| PubChem CID | 101247684 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | (1R,2R,4S)-5-(5,5-dimethyl-1,3-dioxan-2-yl)-8,8-dimethoxy-7-oxobicyclo[2.2.2]oct-5-ene-2-carbonitrile |
| SMILES | COC1(OC)C(=O)[C@@H]2C=C(C3OCC(C)(C)CO3)[C@@H]1C[C@H]2C#N |
| InChI | InChI=1S/C17H23NO5/c1-16(2)8-22-15(23-9-16)12-6-11-10(7-18)5-13(12)17(20-3,21-4)14(11)19/h6,10-11,13,15H,5,8-9H2,1-4H3/t10-,11+,13-/m0/s1 |
| InChIKey | IYPCCGSDBKKAMV-LOWVWBTDSA-N |
| XLogP | 1.66 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|