C34H66O2Si6 — CID 101247962
[3,4-bis(1-adamantyl)-2,2-bis(trimethylsilyl)-1-trimethylsilyloxydisilet-1-yl]oxy-trimethylsilane (PubChem CID 101247962) has the molecular formula C34H66O2Si6 and a molecular weight of 675.42 g/mol. Its IUPAC name is [3,4-bis(1-adamantyl)-2,2-bis(trimethylsilyl)-1-trimethylsilyloxydisilet-1-yl]oxy-trimethylsilane.
| Compound Name | [3,4-bis(1-adamantyl)-2,2-bis(trimethylsilyl)-1-trimethylsilyloxydisilet-1-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 101247962 |
| Molecular Formula | C34H66O2Si6 |
| Molecular Weight | 675.42 g/mol |
| Exact Mass | 674.37 |
| IUPAC Name | [3,4-bis(1-adamantyl)-2,2-bis(trimethylsilyl)-1-trimethylsilyloxydisilet-1-yl]oxy-trimethylsilane |
| SMILES | C[Si](C)(C)O[Si]1(O[Si](C)(C)C)C(C23CC4CC(CC(C4)C2)C3)=C(C23CC4CC(CC(C4)C2)C3)[Si]1([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C34H66O2Si6/c1-37(2,3)35-41(36-38(4,5)6)31(33-19-25-13-26(20-33)15-27(14-25)21-33)32(42(41,39(7,8)9)40(10,11)12)34-22-28-16-29(23-34)18-30(17-28)24-34/h25-30H,13-24H2,1-12H3 |
| InChIKey | HDRYHGMQCIUAMP-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.42 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|