About hydron;3-(trimethylazaniumyl)propane-1-sulfonate
hydron;3-(trimethylazaniumyl)propane-1-sulfonate (PubChem CID 101248025) has the molecular formula C6H16NO3S+
and a molecular weight of 182.26 g/mol. Its IUPAC name is hydron;3-(trimethylazaniumyl)propane-1-sulfonate.
Molecular Properties
| Compound Name | hydron;3-(trimethylazaniumyl)propane-1-sulfonate |
| PubChem CID | 101248025 |
| Molecular Formula | C6H16NO3S+ |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | hydron;3-(trimethylazaniumyl)propane-1-sulfonate |
| SMILES | C[N+](C)(C)CCCS(=O)(=O)[O-].[H+] |
| InChI | InChI=1S/C6H15NO3S/c1-7(2,3)5-4-6-11(8,9)10/h4-6H2,1-3H3/p+1 |
| InChIKey | WFJHXXPYPMNRPK-UHFFFAOYSA-O |
| XLogP | -0.26 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze hydron;3-(trimethylazaniumyl)propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;3-(trimethylazaniumyl)propane-1-sulfonate?
The IUPAC name of hydron;3-(trimethylazaniumyl)propane-1-sulfonate (CID 101248025) is hydron;3-(trimethylazaniumyl)propane-1-sulfonate.
What is the SMILES notation for hydron;3-(trimethylazaniumyl)propane-1-sulfonate?
The canonical SMILES for hydron;3-(trimethylazaniumyl)propane-1-sulfonate is C[N+](C)(C)CCCS(=O)(=O)[O-].[H+].
What is the InChIKey of hydron;3-(trimethylazaniumyl)propane-1-sulfonate?
The InChIKey is WFJHXXPYPMNRPK-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H15NO3S/c1-7(2,3)5-4-6-11(8,9)10/h4-6H2,1-3H3/p+1.
What are the key properties of hydron;3-(trimethylazaniumyl)propane-1-sulfonate?
hydron;3-(trimethylazaniumyl)propane-1-sulfonate has a molecular weight of 182.26 g/mol, XLogP of -0.26, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;3-(trimethylazaniumyl)propane-1-sulfonate is sourced from PubChem (CID 101248025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).