C24H23Cl2NO5 — CID 101248041
(3R,3'S)-5,7-dichloro-1-(methoxymethyl)-3'-(2-methoxyphenyl)-3'-prop-2-enylspiro[indole-3,4'-oxane]-2,2'-dione (PubChem CID 101248041) has the molecular formula C24H23Cl2NO5 and a molecular weight of 476.36 g/mol. Its IUPAC name is (3R,3'S)-5,7-dichloro-1-(methoxymethyl)-3'-(2-methoxyphenyl)-3'-prop-2-enylspiro[indole-3,4'-oxane]-2,2'-dione.
| Compound Name | (3R,3'S)-5,7-dichloro-1-(methoxymethyl)-3'-(2-methoxyphenyl)-3'-prop-2-enylspiro[indole-3,4'-oxane]-2,2'-dione |
|---|---|
| PubChem CID | 101248041 |
| Molecular Formula | C24H23Cl2NO5 |
| Molecular Weight | 476.36 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | (3R,3'S)-5,7-dichloro-1-(methoxymethyl)-3'-(2-methoxyphenyl)-3'-prop-2-enylspiro[indole-3,4'-oxane]-2,2'-dione |
| SMILES | C=CC[C@@]1(c2ccccc2OC)C(=O)OCC[C@]12C(=O)N(COC)c1c(Cl)cc(Cl)cc12 |
| InChI | InChI=1S/C24H23Cl2NO5/c1-4-9-24(16-7-5-6-8-19(16)31-3)22(29)32-11-10-23(24)17-12-15(25)13-18(26)20(17)27(14-30-2)21(23)28/h4-8,12-13H,1,9-11,14H2,2-3H3/t23-,24+/m0/s1 |
| InChIKey | AVHAIPXZRMMODI-BJKOFHAPSA-N |
| XLogP | 4.65 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.36 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|