C28H48O7SSi — CID 101248429
[(4R,5R,7S,8S,9S)-4-[(2S)-1-(benzenesulfonyl)propan-2-yl]-8-(methoxymethoxy)-2,2,7-trimethyl-1,3-dioxaspiro[4.4]nonan-9-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 101248429) has the molecular formula C28H48O7SSi and a molecular weight of 556.84 g/mol. Its IUPAC name is [(4R,5R,7S,8S,9S)-4-[(2S)-1-(benzenesulfonyl)propan-2-yl]-8-(methoxymethoxy)-2,2,7-trimethyl-1,3-dioxaspiro[4.4]nonan-9-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(4R,5R,7S,8S,9S)-4-[(2S)-1-(benzenesulfonyl)propan-2-yl]-8-(methoxymethoxy)-2,2,7-trimethyl-1,3-dioxaspiro[4.4]nonan-9-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 101248429 |
| Molecular Formula | C28H48O7SSi |
| Molecular Weight | 556.84 g/mol |
| Exact Mass | 556.29 |
| IUPAC Name | [(4R,5R,7S,8S,9S)-4-[(2S)-1-(benzenesulfonyl)propan-2-yl]-8-(methoxymethoxy)-2,2,7-trimethyl-1,3-dioxaspiro[4.4]nonan-9-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | COCO[C@H]1[C@@H](C)C[C@@]2(OC(C)(C)O[C@@H]2[C@H](C)CS(=O)(=O)c2ccccc2)[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H48O7SSi/c1-20-16-28(23(24(20)32-19-31-8)17-33-37(9,10)26(3,4)5)25(34-27(6,7)35-28)21(2)18-36(29,30)22-14-12-11-13-15-22/h11-15,20-21,23-25H,16-19H2,1-10H3/t20-,21+,23-,24-,25+,28+/m0/s1 |
| InChIKey | CKNMEIYMNPDXQX-SECZQYNXSA-N |
| XLogP | 5.65 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.84 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|