C17H20N2O2S — CID 101249022
(3aS,4R,6aR)-5-benzyl-2,2-dimethyl-4-(1,3-thiazol-2-yl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole (PubChem CID 101249022) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is (3aS,4R,6aR)-5-benzyl-2,2-dimethyl-4-(1,3-thiazol-2-yl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole.
| Compound Name | (3aS,4R,6aR)-5-benzyl-2,2-dimethyl-4-(1,3-thiazol-2-yl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole |
|---|---|
| PubChem CID | 101249022 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | (3aS,4R,6aR)-5-benzyl-2,2-dimethyl-4-(1,3-thiazol-2-yl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole |
| SMILES | CC1(C)O[C@@H]2[C@@H](CN(Cc3ccccc3)[C@H]2c2nccs2)O1 |
| InChI | InChI=1S/C17H20N2O2S/c1-17(2)20-13-11-19(10-12-6-4-3-5-7-12)14(15(13)21-17)16-18-8-9-22-16/h3-9,13-15H,10-11H2,1-2H3/t13-,14-,15-/m1/s1 |
| InChIKey | WYAFGELIIPPCLU-RBSFLKMASA-N |
| XLogP | 3.22 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |