About [(4-methylbenzoyl)amino] acetate
[(4-methylbenzoyl)amino] acetate (PubChem CID 101249128) has the molecular formula C10H11NO3
and a molecular weight of 193.20 g/mol. Its IUPAC name is [(4-methylbenzoyl)amino] acetate.
Molecular Properties
| Compound Name | [(4-methylbenzoyl)amino] acetate |
| PubChem CID | 101249128 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | [(4-methylbenzoyl)amino] acetate |
| SMILES | CC(=O)ONC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C10H11NO3/c1-7-3-5-9(6-4-7)10(13)11-14-8(2)12/h3-6H,1-2H3,(H,11,13) |
| InChIKey | KJRCQBQTFHIQIM-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(4-methylbenzoyl)amino] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4-methylbenzoyl)amino] acetate?
The IUPAC name of [(4-methylbenzoyl)amino] acetate (CID 101249128) is [(4-methylbenzoyl)amino] acetate.
What is the SMILES notation for [(4-methylbenzoyl)amino] acetate?
The canonical SMILES for [(4-methylbenzoyl)amino] acetate is CC(=O)ONC(=O)c1ccc(C)cc1.
What is the InChIKey of [(4-methylbenzoyl)amino] acetate?
The InChIKey is KJRCQBQTFHIQIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO3/c1-7-3-5-9(6-4-7)10(13)11-14-8(2)12/h3-6H,1-2H3,(H,11,13).
What are the key properties of [(4-methylbenzoyl)amino] acetate?
[(4-methylbenzoyl)amino] acetate has a molecular weight of 193.20 g/mol, XLogP of 1.20, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(4-methylbenzoyl)amino] acetate is sourced from PubChem (CID 101249128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).