C11H16 — CID 101249321
(1S,3S,4S,6R)-3,4-dimethyltricyclo[4.2.1.02,5]non-2(5)-ene (PubChem CID 101249321) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is (1S,3S,4S,6R)-3,4-dimethyltricyclo[4.2.1.02,5]non-2(5)-ene.
| Compound Name | (1S,3S,4S,6R)-3,4-dimethyltricyclo[4.2.1.02,5]non-2(5)-ene |
|---|---|
| PubChem CID | 101249321 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | (1S,3S,4S,6R)-3,4-dimethyltricyclo[4.2.1.02,5]non-2(5)-ene |
| SMILES | C[C@@H]1C2=C([C@H]3CC[C@@H]2C3)[C@H]1C |
| InChI | InChI=1S/C11H16/c1-6-7(2)11-9-4-3-8(5-9)10(6)11/h6-9H,3-5H2,1-2H3/t6-,7-,8-,9+/m0/s1 |
| InChIKey | DKMZHQCIHICTSM-XSPKLOCKSA-N |
| XLogP | 3.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|