C49H34N2O10 — CID 101249495
2-[4-[4-[2-[4-[4-(5-carboxy-1,3-dioxoisoindol-2-yl)phenoxy]phenyl]-2-bicyclo[2.2.1]heptanyl]phenoxy]phenyl]-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 101249495) has the molecular formula C49H34N2O10 and a molecular weight of 810.81 g/mol. Its IUPAC name is 2-[4-[4-[2-[4-[4-(5-carboxy-1,3-dioxoisoindol-2-yl)phenoxy]phenyl]-2-bicyclo[2.2.1]heptanyl]phenoxy]phenyl]-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[4-[4-[2-[4-[4-(5-carboxy-1,3-dioxoisoindol-2-yl)phenoxy]phenyl]-2-bicyclo[2.2.1]heptanyl]phenoxy]phenyl]-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 101249495 |
| Molecular Formula | C49H34N2O10 |
| Molecular Weight | 810.81 g/mol |
| Exact Mass | 810.22 |
| IUPAC Name | 2-[4-[4-[2-[4-[4-(5-carboxy-1,3-dioxoisoindol-2-yl)phenoxy]phenyl]-2-bicyclo[2.2.1]heptanyl]phenoxy]phenyl]-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)N(c1ccc(Oc3ccc(C4(c5ccc(Oc6ccc(N7C(=O)c8ccc(C(=O)O)cc8C7=O)cc6)cc5)CC5CCC4C5)cc3)cc1)C2=O |
| InChI | InChI=1S/C49H34N2O10/c52-43-39-21-2-28(47(56)57)24-41(39)45(54)50(43)33-9-17-37(18-10-33)60-35-13-5-30(6-14-35)49(26-27-1-4-32(49)23-27)31-7-15-36(16-8-31)61-38-19-11-34(12-20-38)51-44(53)40-22-3-29(48(58)59)25-42(40)46(51)55/h2-3,5-22,24-25,27,32H,1,4,23,26H2,(H,56,57)(H,58,59) |
| InChIKey | UGYPMBAVLOYCIB-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 167.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.81 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide_misc(2)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|