C16H22N2O9 — CID 101249548
ethyl 3-[(3aR,5S,6R,6aR)-6-(2-ethoxy-2-oxoethoxy)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-diazo-3-oxopropanoate (PubChem CID 101249548) has the molecular formula C16H22N2O9 and a molecular weight of 386.36 g/mol. Its IUPAC name is ethyl 3-[(3aR,5S,6R,6aR)-6-(2-ethoxy-2-oxoethoxy)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-diazo-3-oxopropanoate.
| Compound Name | ethyl 3-[(3aR,5S,6R,6aR)-6-(2-ethoxy-2-oxoethoxy)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-diazo-3-oxopropanoate |
|---|---|
| PubChem CID | 101249548 |
| Molecular Formula | C16H22N2O9 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | ethyl 3-[(3aR,5S,6R,6aR)-6-(2-ethoxy-2-oxoethoxy)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-diazo-3-oxopropanoate |
| SMILES | CCOC(=O)CO[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1C(=O)C(=[N+]=[N-])C(=O)OCC |
| InChI | InChI=1S/C16H22N2O9/c1-5-22-8(19)7-24-12-11(10(20)9(18-17)14(21)23-6-2)25-15-13(12)26-16(3,4)27-15/h11-13,15H,5-7H2,1-4H3/t11-,12+,13-,15-/m1/s1 |
| InChIKey | ZGEVAXIBLHHXFU-QVHKTLOISA-N |
| XLogP | -0.39 |
| TPSA | 142.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|