C19H23OPS2 — CID 101250155
(4S,6R)-2-diphenylphosphoryl-2,4,6-trimethyl-1,3-dithiane (PubChem CID 101250155) has the molecular formula C19H23OPS2 and a molecular weight of 362.50 g/mol. Its IUPAC name is (4S,6R)-2-diphenylphosphoryl-2,4,6-trimethyl-1,3-dithiane.
| Compound Name | (4S,6R)-2-diphenylphosphoryl-2,4,6-trimethyl-1,3-dithiane |
|---|---|
| PubChem CID | 101250155 |
| Molecular Formula | C19H23OPS2 |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | (4S,6R)-2-diphenylphosphoryl-2,4,6-trimethyl-1,3-dithiane |
| SMILES | C[C@@H]1C[C@H](C)SC(C)(P(=O)(c2ccccc2)c2ccccc2)S1 |
| InChI | InChI=1S/C19H23OPS2/c1-15-14-16(2)23-19(3,22-15)21(20,17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-13,15-16H,14H2,1-3H3/t15-,16+,19? |
| InChIKey | GCVUOHVSRZLSJD-MCPYQZEQSA-N |
| XLogP | 5.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|