C23H36O8 — CID 101250256
(1R,2R,6R,7S)-10-(5,5-dimethyl-1,3-dioxan-2-yl)-4-[(1R)-1-hydroxy-2-methylpropyl]-4,9,9-trimethoxy-3-oxatricyclo[5.2.2.02,6]undec-10-en-8-one (PubChem CID 101250256) has the molecular formula C23H36O8 and a molecular weight of 440.53 g/mol. Its IUPAC name is (1R,2R,6R,7S)-10-(5,5-dimethyl-1,3-dioxan-2-yl)-4-[(1R)-1-hydroxy-2-methylpropyl]-4,9,9-trimethoxy-3-oxatricyclo[5.2.2.02,6]undec-10-en-8-one.
| Compound Name | (1R,2R,6R,7S)-10-(5,5-dimethyl-1,3-dioxan-2-yl)-4-[(1R)-1-hydroxy-2-methylpropyl]-4,9,9-trimethoxy-3-oxatricyclo[5.2.2.02,6]undec-10-en-8-one |
|---|---|
| PubChem CID | 101250256 |
| Molecular Formula | C23H36O8 |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | (1R,2R,6R,7S)-10-(5,5-dimethyl-1,3-dioxan-2-yl)-4-[(1R)-1-hydroxy-2-methylpropyl]-4,9,9-trimethoxy-3-oxatricyclo[5.2.2.02,6]undec-10-en-8-one |
| SMILES | COC1([C@H](O)C(C)C)C[C@H]2[C@@H](O1)[C@H]1C(C3OCC(C)(C)CO3)=C[C@@H]2C(=O)C1(OC)OC |
| InChI | InChI=1S/C23H36O8/c1-12(2)18(24)22(26-5)9-15-13-8-14(20-29-10-21(3,4)11-30-20)16(17(15)31-22)23(27-6,28-7)19(13)25/h8,12-13,15-18,20,24H,9-11H2,1-7H3/t13-,15+,16+,17+,18+,22?/m0/s1 |
| InChIKey | ZGXQQDDVWUZNHK-ZAGXWNNSSA-N |
| XLogP | 1.89 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|