C25H30OS2 — CID 101250788
(1R,4S)-5,6-ditert-butyl-3,3-diphenyl-2,7λ4-dithiabicyclo[2.2.1]hept-5-ene 7-oxide (PubChem CID 101250788) has the molecular formula C25H30OS2 and a molecular weight of 410.65 g/mol. Its IUPAC name is (1R,4S)-5,6-ditert-butyl-3,3-diphenyl-2,7λ4-dithiabicyclo[2.2.1]hept-5-ene 7-oxide.
| Compound Name | (1R,4S)-5,6-ditert-butyl-3,3-diphenyl-2,7λ4-dithiabicyclo[2.2.1]hept-5-ene 7-oxide |
|---|---|
| PubChem CID | 101250788 |
| Molecular Formula | C25H30OS2 |
| Molecular Weight | 410.65 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | (1R,4S)-5,6-ditert-butyl-3,3-diphenyl-2,7λ4-dithiabicyclo[2.2.1]hept-5-ene 7-oxide |
| SMILES | CC(C)(C)C1=C(C(C)(C)C)[C@@H]2SC(c3ccccc3)(c3ccccc3)C1S2=O |
| InChI | InChI=1S/C25H30OS2/c1-23(2,3)19-20(24(4,5)6)22-27-25(21(19)28(22)26,17-13-9-7-10-14-17)18-15-11-8-12-16-18/h7-16,21-22H,1-6H3/t21?,22-,28?/m1/s1 |
| InChIKey | VMGXRIABFLQLOF-ZMJILXOLSA-N |
| XLogP | 6.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.65 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|