About (1R)-2-(methylamino)-1-(1,3-thiazol-2-yl)ethanol
(1R)-2-(methylamino)-1-(1,3-thiazol-2-yl)ethanol (PubChem CID 10125085) has the molecular formula C6H10N2OS
and a molecular weight of 158.23 g/mol. Its IUPAC name is (1R)-2-(methylamino)-1-(1,3-thiazol-2-yl)ethanol.
Molecular Properties
| Compound Name | (1R)-2-(methylamino)-1-(1,3-thiazol-2-yl)ethanol |
| PubChem CID | 10125085 |
| Molecular Formula | C6H10N2OS |
| Molecular Weight | 158.23 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | (1R)-2-(methylamino)-1-(1,3-thiazol-2-yl)ethanol |
| SMILES | CNC[C@@H](O)c1nccs1 |
| InChI | InChI=1S/C6H10N2OS/c1-7-4-5(9)6-8-2-3-10-6/h2-3,5,7,9H,4H2,1H3/t5-/m1/s1 |
| InChIKey | LPLVAFVDSNSTMZ-RXMQYKEDSA-N |
| XLogP | 0.40 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.23 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1R)-2-(methylamino)-1-(1,3-thiazol-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-2-(methylamino)-1-(1,3-thiazol-2-yl)ethanol?
The IUPAC name of (1R)-2-(methylamino)-1-(1,3-thiazol-2-yl)ethanol (CID 10125085) is (1R)-2-(methylamino)-1-(1,3-thiazol-2-yl)ethanol.
What is the SMILES notation for (1R)-2-(methylamino)-1-(1,3-thiazol-2-yl)ethanol?
The canonical SMILES for (1R)-2-(methylamino)-1-(1,3-thiazol-2-yl)ethanol is CNC[C@@H](O)c1nccs1.
What is the InChIKey of (1R)-2-(methylamino)-1-(1,3-thiazol-2-yl)ethanol?
The InChIKey is LPLVAFVDSNSTMZ-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H10N2OS/c1-7-4-5(9)6-8-2-3-10-6/h2-3,5,7,9H,4H2,1H3/t5-/m1/s1.
What are the key properties of (1R)-2-(methylamino)-1-(1,3-thiazol-2-yl)ethanol?
(1R)-2-(methylamino)-1-(1,3-thiazol-2-yl)ethanol has a molecular weight of 158.23 g/mol, XLogP of 0.40, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2-(methylamino)-1-(1,3-thiazol-2-yl)ethanol is sourced from PubChem (CID 10125085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).