C13H19NO3S — CID 101250949
[(2R,3S,4S)-1,4-dimethyl-3-phenylazetidin-2-yl]methyl methanesulfonate (PubChem CID 101250949) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is [(2R,3S,4S)-1,4-dimethyl-3-phenylazetidin-2-yl]methyl methanesulfonate.
| Compound Name | [(2R,3S,4S)-1,4-dimethyl-3-phenylazetidin-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 101250949 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | [(2R,3S,4S)-1,4-dimethyl-3-phenylazetidin-2-yl]methyl methanesulfonate |
| SMILES | C[C@H]1[C@H](c2ccccc2)[C@H](COS(C)(=O)=O)N1C |
| InChI | InChI=1S/C13H19NO3S/c1-10-13(11-7-5-4-6-8-11)12(14(10)2)9-17-18(3,15)16/h4-8,10,12-13H,9H2,1-3H3/t10-,12-,13+/m0/s1 |
| InChIKey | IPYLVBCEOHFUEE-WCFLWFBJSA-N |
| XLogP | 1.45 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|