C18H19NO4 — CID 101251096
2-(3,4-dimethoxyphenyl)-5-[(1E,3E)-penta-1,3-dienyl]-6-oxa-4-azaspiro[2.4]hept-4-en-7-one (PubChem CID 101251096) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5-[(1E,3E)-penta-1,3-dienyl]-6-oxa-4-azaspiro[2.4]hept-4-en-7-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5-[(1E,3E)-penta-1,3-dienyl]-6-oxa-4-azaspiro[2.4]hept-4-en-7-one |
|---|---|
| PubChem CID | 101251096 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5-[(1E,3E)-penta-1,3-dienyl]-6-oxa-4-azaspiro[2.4]hept-4-en-7-one |
| SMILES | C/C=C/C=C/C1=NC2(CC2c2ccc(OC)c(OC)c2)C(=O)O1 |
| InChI | InChI=1S/C18H19NO4/c1-4-5-6-7-16-19-18(17(20)23-16)11-13(18)12-8-9-14(21-2)15(10-12)22-3/h4-10,13H,11H2,1-3H3/b5-4+,7-6+ |
| InChIKey | XPDNOGHJRIOXAD-YTXTXJHMSA-N |
| XLogP | 3.02 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|