C18H22O6 — CID 101251136
dimethyl (1S,2S,6R,7R)-4-butyl-7-methyl-5-oxo-10-oxatricyclo[5.2.1.02,6]deca-3,8-diene-8,9-dicarboxylate (PubChem CID 101251136) has the molecular formula C18H22O6 and a molecular weight of 334.37 g/mol. Its IUPAC name is dimethyl (1S,2S,6R,7R)-4-butyl-7-methyl-5-oxo-10-oxatricyclo[5.2.1.02,6]deca-3,8-diene-8,9-dicarboxylate.
| Compound Name | dimethyl (1S,2S,6R,7R)-4-butyl-7-methyl-5-oxo-10-oxatricyclo[5.2.1.02,6]deca-3,8-diene-8,9-dicarboxylate |
|---|---|
| PubChem CID | 101251136 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | dimethyl (1S,2S,6R,7R)-4-butyl-7-methyl-5-oxo-10-oxatricyclo[5.2.1.02,6]deca-3,8-diene-8,9-dicarboxylate |
| SMILES | CCCCC1=C[C@@H]2[C@@H]3O[C@@](C)(C(C(=O)OC)=C3C(=O)OC)[C@@H]2C1=O |
| InChI | InChI=1S/C18H22O6/c1-5-6-7-9-8-10-12(14(9)19)18(2)13(17(21)23-4)11(15(10)24-18)16(20)22-3/h8,10,12,15H,5-7H2,1-4H3/t10-,12-,15-,18+/m0/s1 |
| InChIKey | PTAHVCNYVVHWAW-GHPXYFHISA-N |
| XLogP | 1.73 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |