About (2R)-7-phenylhepta-4,6-diyn-2-ol
(2R)-7-phenylhepta-4,6-diyn-2-ol (PubChem CID 10125118) has the molecular formula C13H12O
and a molecular weight of 184.24 g/mol. Its IUPAC name is (2R)-7-phenylhepta-4,6-diyn-2-ol.
Molecular Properties
| Compound Name | (2R)-7-phenylhepta-4,6-diyn-2-ol |
| PubChem CID | 10125118 |
| Molecular Formula | C13H12O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | (2R)-7-phenylhepta-4,6-diyn-2-ol |
| SMILES | C[C@@H](O)CC#CC#Cc1ccccc1 |
| InChI | InChI=1S/C13H12O/c1-12(14)8-4-2-5-9-13-10-6-3-7-11-13/h3,6-7,10-12,14H,8H2,1H3/t12-/m1/s1 |
| InChIKey | QUBDTHLFIKDCBG-GFCCVEGCSA-N |
| XLogP | 1.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R)-7-phenylhepta-4,6-diyn-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-7-phenylhepta-4,6-diyn-2-ol?
The IUPAC name of (2R)-7-phenylhepta-4,6-diyn-2-ol (CID 10125118) is (2R)-7-phenylhepta-4,6-diyn-2-ol.
What is the SMILES notation for (2R)-7-phenylhepta-4,6-diyn-2-ol?
The canonical SMILES for (2R)-7-phenylhepta-4,6-diyn-2-ol is C[C@@H](O)CC#CC#Cc1ccccc1.
What is the InChIKey of (2R)-7-phenylhepta-4,6-diyn-2-ol?
The InChIKey is QUBDTHLFIKDCBG-GFCCVEGCSA-N. The full InChI is InChI=1S/C13H12O/c1-12(14)8-4-2-5-9-13-10-6-3-7-11-13/h3,6-7,10-12,14H,8H2,1H3/t12-/m1/s1.
What are the key properties of (2R)-7-phenylhepta-4,6-diyn-2-ol?
(2R)-7-phenylhepta-4,6-diyn-2-ol has a molecular weight of 184.24 g/mol, XLogP of 1.81, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-7-phenylhepta-4,6-diyn-2-ol is sourced from PubChem (CID 10125118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).