C32H39NO6SSi — CID 101251518
tert-butyl-[[(1R,2S,5S,7R)-9,9-dimethyl-3-(4-methylphenyl)sulfonyl-6,8,10-trioxa-3-azatricyclo[5.3.0.02,5]decan-5-yl]methoxy]-diphenylsilane (PubChem CID 101251518) has the molecular formula C32H39NO6SSi and a molecular weight of 593.82 g/mol. Its IUPAC name is tert-butyl-[[(1R,2S,5S,7R)-9,9-dimethyl-3-(4-methylphenyl)sulfonyl-6,8,10-trioxa-3-azatricyclo[5.3.0.02,5]decan-5-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(1R,2S,5S,7R)-9,9-dimethyl-3-(4-methylphenyl)sulfonyl-6,8,10-trioxa-3-azatricyclo[5.3.0.02,5]decan-5-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 101251518 |
| Molecular Formula | C32H39NO6SSi |
| Molecular Weight | 593.82 g/mol |
| Exact Mass | 593.23 |
| IUPAC Name | tert-butyl-[[(1R,2S,5S,7R)-9,9-dimethyl-3-(4-methylphenyl)sulfonyl-6,8,10-trioxa-3-azatricyclo[5.3.0.02,5]decan-5-yl]methoxy]-diphenylsilane |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@]3(CO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)O[C@@H]4OC(C)(C)O[C@@H]4[C@H]23)cc1 |
| InChI | InChI=1S/C32H39NO6SSi/c1-23-17-19-24(20-18-23)40(34,35)33-21-32(28(33)27-29(39-32)38-31(5,6)37-27)22-36-41(30(2,3)4,25-13-9-7-10-14-25)26-15-11-8-12-16-26/h7-20,27-29H,21-22H2,1-6H3/t27-,28+,29+,32-/m1/s1 |
| InChIKey | DOKPCXOHKBWADW-AAVCQDEJSA-N |
| XLogP | 4.19 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.82 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|