About 6-phenylnaphthalen-2-ol
6-phenylnaphthalen-2-ol (PubChem CID 10125182) has the molecular formula C16H12O
and a molecular weight of 220.27 g/mol. Its IUPAC name is 6-phenylnaphthalen-2-ol.
Molecular Properties
| Compound Name | 6-phenylnaphthalen-2-ol |
| PubChem CID | 10125182 |
| Molecular Formula | C16H12O |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 6-phenylnaphthalen-2-ol |
| SMILES | Oc1ccc2cc(-c3ccccc3)ccc2c1 |
| InChI | InChI=1S/C16H12O/c17-16-9-8-14-10-13(6-7-15(14)11-16)12-4-2-1-3-5-12/h1-11,17H |
| InChIKey | PZOXFBPKKGTQDZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-phenylnaphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenylnaphthalen-2-ol?
The IUPAC name of 6-phenylnaphthalen-2-ol (CID 10125182) is 6-phenylnaphthalen-2-ol.
What is the SMILES notation for 6-phenylnaphthalen-2-ol?
The canonical SMILES for 6-phenylnaphthalen-2-ol is Oc1ccc2cc(-c3ccccc3)ccc2c1.
What is the InChIKey of 6-phenylnaphthalen-2-ol?
The InChIKey is PZOXFBPKKGTQDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12O/c17-16-9-8-14-10-13(6-7-15(14)11-16)12-4-2-1-3-5-12/h1-11,17H.
What are the key properties of 6-phenylnaphthalen-2-ol?
6-phenylnaphthalen-2-ol has a molecular weight of 220.27 g/mol, XLogP of 4.21, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenylnaphthalen-2-ol is sourced from PubChem (CID 10125182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).