C14H20N2O2S2 — CID 101251924
(1Z)-5,16-dimethyl-9,12-dioxa-3,18-dithia-6,15-diazatricyclo[13.3.0.02,6]octadeca-1,4,16-triene (PubChem CID 101251924) has the molecular formula C14H20N2O2S2 and a molecular weight of 312.46 g/mol. Its IUPAC name is (1Z)-5,16-dimethyl-9,12-dioxa-3,18-dithia-6,15-diazatricyclo[13.3.0.02,6]octadeca-1,4,16-triene.
| Compound Name | (1Z)-5,16-dimethyl-9,12-dioxa-3,18-dithia-6,15-diazatricyclo[13.3.0.02,6]octadeca-1,4,16-triene |
|---|---|
| PubChem CID | 101251924 |
| Molecular Formula | C14H20N2O2S2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | (1Z)-5,16-dimethyl-9,12-dioxa-3,18-dithia-6,15-diazatricyclo[13.3.0.02,6]octadeca-1,4,16-triene |
| SMILES | CC1=CS/C2=C3\SC=C(C)N3CCOCCOCCN12 |
| InChI | InChI=1S/C14H20N2O2S2/c1-11-9-19-13-14-16(12(2)10-20-14)4-6-18-8-7-17-5-3-15(11)13/h9-10H,3-8H2,1-2H3/b14-13- |
| InChIKey | GCSPQAUCMQFOPP-YPKPFQOOSA-N |
| XLogP | 2.98 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |