About methyl 6-but-3-en-2-yl-3,6-dihydro-2H-pyridine-1-carboxylate
methyl 6-but-3-en-2-yl-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 101252005) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is methyl 6-but-3-en-2-yl-3,6-dihydro-2H-pyridine-1-carboxylate.
Molecular Properties
| Compound Name | methyl 6-but-3-en-2-yl-3,6-dihydro-2H-pyridine-1-carboxylate |
| PubChem CID | 101252005 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | methyl 6-but-3-en-2-yl-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | C=CC(C)C1C=CCCN1C(=O)OC |
| InChI | InChI=1S/C11H17NO2/c1-4-9(2)10-7-5-6-8-12(10)11(13)14-3/h4-5,7,9-10H,1,6,8H2,2-3H3 |
| InChIKey | HYWZCHGRWDHQFJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-but-3-en-2-yl-3,6-dihydro-2H-pyridine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-but-3-en-2-yl-3,6-dihydro-2H-pyridine-1-carboxylate?
The IUPAC name of methyl 6-but-3-en-2-yl-3,6-dihydro-2H-pyridine-1-carboxylate (CID 101252005) is methyl 6-but-3-en-2-yl-3,6-dihydro-2H-pyridine-1-carboxylate.
What is the SMILES notation for methyl 6-but-3-en-2-yl-3,6-dihydro-2H-pyridine-1-carboxylate?
The canonical SMILES for methyl 6-but-3-en-2-yl-3,6-dihydro-2H-pyridine-1-carboxylate is C=CC(C)C1C=CCCN1C(=O)OC.
What is the InChIKey of methyl 6-but-3-en-2-yl-3,6-dihydro-2H-pyridine-1-carboxylate?
The InChIKey is HYWZCHGRWDHQFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2/c1-4-9(2)10-7-5-6-8-12(10)11(13)14-3/h4-5,7,9-10H,1,6,8H2,2-3H3.
What are the key properties of methyl 6-but-3-en-2-yl-3,6-dihydro-2H-pyridine-1-carboxylate?
methyl 6-but-3-en-2-yl-3,6-dihydro-2H-pyridine-1-carboxylate has a molecular weight of 195.26 g/mol, XLogP of 2.21, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-but-3-en-2-yl-3,6-dihydro-2H-pyridine-1-carboxylate is sourced from PubChem (CID 101252005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).