About 2-(butan-2-yldisulfanyl)-1,3-benzothiazole
2-(butan-2-yldisulfanyl)-1,3-benzothiazole (PubChem CID 10125295) has the molecular formula C11H13NS3
and a molecular weight of 255.43 g/mol. Its IUPAC name is 2-(butan-2-yldisulfanyl)-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-(butan-2-yldisulfanyl)-1,3-benzothiazole |
| PubChem CID | 10125295 |
| Molecular Formula | C11H13NS3 |
| Molecular Weight | 255.43 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | 2-(butan-2-yldisulfanyl)-1,3-benzothiazole |
| SMILES | CCC(C)SSc1nc2ccccc2s1 |
| InChI | InChI=1S/C11H13NS3/c1-3-8(2)14-15-11-12-9-6-4-5-7-10(9)13-11/h4-8H,3H2,1-2H3 |
| InChIKey | SEBPGRSSPNLOGD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 2-(butan-2-yldisulfanyl)-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(butan-2-yldisulfanyl)-1,3-benzothiazole?
The IUPAC name of 2-(butan-2-yldisulfanyl)-1,3-benzothiazole (CID 10125295) is 2-(butan-2-yldisulfanyl)-1,3-benzothiazole.
What is the SMILES notation for 2-(butan-2-yldisulfanyl)-1,3-benzothiazole?
The canonical SMILES for 2-(butan-2-yldisulfanyl)-1,3-benzothiazole is CCC(C)SSc1nc2ccccc2s1.
What is the InChIKey of 2-(butan-2-yldisulfanyl)-1,3-benzothiazole?
The InChIKey is SEBPGRSSPNLOGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NS3/c1-3-8(2)14-15-11-12-9-6-4-5-7-10(9)13-11/h4-8H,3H2,1-2H3.
What are the key properties of 2-(butan-2-yldisulfanyl)-1,3-benzothiazole?
2-(butan-2-yldisulfanyl)-1,3-benzothiazole has a molecular weight of 255.43 g/mol, XLogP of 4.84, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(butan-2-yldisulfanyl)-1,3-benzothiazole is sourced from PubChem (CID 10125295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).