C18H30N2O — CID 101253123
(5E,9E)-2-(dimethylamino)-5,8,8-trimethyl-11-oxotrideca-5,9-dienenitrile (PubChem CID 101253123) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is (5E,9E)-2-(dimethylamino)-5,8,8-trimethyl-11-oxotrideca-5,9-dienenitrile.
| Compound Name | (5E,9E)-2-(dimethylamino)-5,8,8-trimethyl-11-oxotrideca-5,9-dienenitrile |
|---|---|
| PubChem CID | 101253123 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | (5E,9E)-2-(dimethylamino)-5,8,8-trimethyl-11-oxotrideca-5,9-dienenitrile |
| SMILES | CCC(=O)/C=C/C(C)(C)C/C=C(\C)CCC(C#N)N(C)C |
| InChI | InChI=1S/C18H30N2O/c1-7-17(21)11-13-18(3,4)12-10-15(2)8-9-16(14-19)20(5)6/h10-11,13,16H,7-9,12H2,1-6H3/b13-11+,15-10+ |
| InChIKey | CWENIAPNUIOVFK-KGQZWIPFSA-N |
| XLogP | 4.12 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|