C16H15F3N2O4S — CID 101253170
(3R,6S,7S,8aS)-5-oxo-7-phenyl-6-[(2,2,2-trifluoroacetyl)amino]-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylic acid (PubChem CID 101253170) has the molecular formula C16H15F3N2O4S and a molecular weight of 388.37 g/mol. Its IUPAC name is (3R,6S,7S,8aS)-5-oxo-7-phenyl-6-[(2,2,2-trifluoroacetyl)amino]-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylic acid.
| Compound Name | (3R,6S,7S,8aS)-5-oxo-7-phenyl-6-[(2,2,2-trifluoroacetyl)amino]-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 101253170 |
| Molecular Formula | C16H15F3N2O4S |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | (3R,6S,7S,8aS)-5-oxo-7-phenyl-6-[(2,2,2-trifluoroacetyl)amino]-2,3,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CS[C@H]2C[C@@H](c3ccccc3)[C@H](NC(=O)C(F)(F)F)C(=O)N21 |
| InChI | InChI=1S/C16H15F3N2O4S/c17-16(18,19)15(25)20-12-9(8-4-2-1-3-5-8)6-11-21(13(12)22)10(7-26-11)14(23)24/h1-5,9-12H,6-7H2,(H,20,25)(H,23,24)/t9-,10-,11-,12-/m0/s1 |
| InChIKey | CQMWRFQMPQJCHB-BJDJZHNGSA-N |
| XLogP | 1.58 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |