C23H14F6N4S2 — CID 101253185
5-[3,3,4,4,5,5-hexafluoro-2-(4-methyl-2-pyridin-2-yl-1,3-thiazol-5-yl)cyclopenten-1-yl]-4-methyl-2-pyridin-2-yl-1,3-thiazole (PubChem CID 101253185) has the molecular formula C23H14F6N4S2 and a molecular weight of 524.52 g/mol. Its IUPAC name is 5-[3,3,4,4,5,5-hexafluoro-2-(4-methyl-2-pyridin-2-yl-1,3-thiazol-5-yl)cyclopenten-1-yl]-4-methyl-2-pyridin-2-yl-1,3-thiazole.
| Compound Name | 5-[3,3,4,4,5,5-hexafluoro-2-(4-methyl-2-pyridin-2-yl-1,3-thiazol-5-yl)cyclopenten-1-yl]-4-methyl-2-pyridin-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 101253185 |
| Molecular Formula | C23H14F6N4S2 |
| Molecular Weight | 524.52 g/mol |
| Exact Mass | 524.06 |
| IUPAC Name | 5-[3,3,4,4,5,5-hexafluoro-2-(4-methyl-2-pyridin-2-yl-1,3-thiazol-5-yl)cyclopenten-1-yl]-4-methyl-2-pyridin-2-yl-1,3-thiazole |
| SMILES | Cc1nc(-c2ccccn2)sc1C1=C(c2sc(-c3ccccn3)nc2C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C23H14F6N4S2/c1-11-17(34-19(32-11)13-7-3-5-9-30-13)15-16(22(26,27)23(28,29)21(15,24)25)18-12(2)33-20(35-18)14-8-4-6-10-31-14/h3-10H,1-2H3 |
| InChIKey | PWPKXYMYQORIJB-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.52 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|