C29H35NO2 — CID 101253321
(3S,6R,8R,10S,11S,14S)-2,2,6,11-tetramethyl-12,12-diphenyl-9-oxa-1-azatetracyclo[8.5.0.03,8.011,14]pentadecan-15-one (PubChem CID 101253321) has the molecular formula C29H35NO2 and a molecular weight of 429.60 g/mol. Its IUPAC name is (3S,6R,8R,10S,11S,14S)-2,2,6,11-tetramethyl-12,12-diphenyl-9-oxa-1-azatetracyclo[8.5.0.03,8.011,14]pentadecan-15-one.
| Compound Name | (3S,6R,8R,10S,11S,14S)-2,2,6,11-tetramethyl-12,12-diphenyl-9-oxa-1-azatetracyclo[8.5.0.03,8.011,14]pentadecan-15-one |
|---|---|
| PubChem CID | 101253321 |
| Molecular Formula | C29H35NO2 |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | (3S,6R,8R,10S,11S,14S)-2,2,6,11-tetramethyl-12,12-diphenyl-9-oxa-1-azatetracyclo[8.5.0.03,8.011,14]pentadecan-15-one |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](C1)O[C@@H]1N(C(=O)[C@H]3CC(c4ccccc4)(c4ccccc4)[C@]31C)C2(C)C |
| InChI | InChI=1S/C29H35NO2/c1-19-15-16-22-24(17-19)32-26-28(4)23(25(31)30(26)27(22,2)3)18-29(28,20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-14,19,22-24,26H,15-18H2,1-4H3/t19-,22-,23-,24-,26+,28-/m1/s1 |
| InChIKey | BIKMMJAGIDDAEL-IWPUBZGJSA-N |
| XLogP | 5.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.60 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |