About (4R,5R)-3-benzyl-2,5-diphenyl-4-pyridin-4-yl-4H-imidazole-5-carboxylic acid
(4R,5R)-3-benzyl-2,5-diphenyl-4-pyridin-4-yl-4H-imidazole-5-carboxylic acid (PubChem CID 101253376) has the molecular formula C28H23N3O2
and a molecular weight of 433.51 g/mol. Its IUPAC name is (4R,5R)-3-benzyl-2,5-diphenyl-4-pyridin-4-yl-4H-imidazole-5-carboxylic acid.
Molecular Properties
| Compound Name | (4R,5R)-3-benzyl-2,5-diphenyl-4-pyridin-4-yl-4H-imidazole-5-carboxylic acid |
| PubChem CID | 101253376 |
| Molecular Formula | C28H23N3O2 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | (4R,5R)-3-benzyl-2,5-diphenyl-4-pyridin-4-yl-4H-imidazole-5-carboxylic acid |
| SMILES | O=C(O)[C@]1(c2ccccc2)N=C(c2ccccc2)N(Cc2ccccc2)[C@@H]1c1ccncc1 |
| InChI | InChI=1S/C28H23N3O2/c32-27(33)28(24-14-8-3-9-15-24)25(22-16-18-29-19-17-22)31(20-21-10-4-1-5-11-21)26(30-28)23-12-6-2-7-13-23/h1-19,25H,20H2,(H,32,33)/t25-,28-/m1/s1 |
| InChIKey | DVBHKFXHPYZHTA-LEAFIULHSA-N |
| XLogP | 5.07 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4R,5R)-3-benzyl-2,5-diphenyl-4-pyridin-4-yl-4H-imidazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5R)-3-benzyl-2,5-diphenyl-4-pyridin-4-yl-4H-imidazole-5-carboxylic acid?
The IUPAC name of (4R,5R)-3-benzyl-2,5-diphenyl-4-pyridin-4-yl-4H-imidazole-5-carboxylic acid (CID 101253376) is (4R,5R)-3-benzyl-2,5-diphenyl-4-pyridin-4-yl-4H-imidazole-5-carboxylic acid.
What is the SMILES notation for (4R,5R)-3-benzyl-2,5-diphenyl-4-pyridin-4-yl-4H-imidazole-5-carboxylic acid?
The canonical SMILES for (4R,5R)-3-benzyl-2,5-diphenyl-4-pyridin-4-yl-4H-imidazole-5-carboxylic acid is O=C(O)[C@]1(c2ccccc2)N=C(c2ccccc2)N(Cc2ccccc2)[C@@H]1c1ccncc1.
What is the InChIKey of (4R,5R)-3-benzyl-2,5-diphenyl-4-pyridin-4-yl-4H-imidazole-5-carboxylic acid?
The InChIKey is DVBHKFXHPYZHTA-LEAFIULHSA-N. The full InChI is InChI=1S/C28H23N3O2/c32-27(33)28(24-14-8-3-9-15-24)25(22-16-18-29-19-17-22)31(20-21-10-4-1-5-11-21)26(30-28)23-12-6-2-7-13-23/h1-19,25H,20H2,(H,32,33)/t25-,28-/m1/s1.
What are the key properties of (4R,5R)-3-benzyl-2,5-diphenyl-4-pyridin-4-yl-4H-imidazole-5-carboxylic acid?
(4R,5R)-3-benzyl-2,5-diphenyl-4-pyridin-4-yl-4H-imidazole-5-carboxylic acid has a molecular weight of 433.51 g/mol, XLogP of 5.07, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5R)-3-benzyl-2,5-diphenyl-4-pyridin-4-yl-4H-imidazole-5-carboxylic acid is sourced from PubChem (CID 101253376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).