C30H45NO2Si — CID 101253754
tert-butyl-[3-[(2E,6E)-9-[(2S,3S)-3-ethenyl-3-methyloxiran-2-yl]-3,7-dimethylnona-2,6-dienyl]indol-1-yl]oxy-dimethylsilane (PubChem CID 101253754) has the molecular formula C30H45NO2Si and a molecular weight of 479.78 g/mol. Its IUPAC name is tert-butyl-[3-[(2E,6E)-9-[(2S,3S)-3-ethenyl-3-methyloxiran-2-yl]-3,7-dimethylnona-2,6-dienyl]indol-1-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[3-[(2E,6E)-9-[(2S,3S)-3-ethenyl-3-methyloxiran-2-yl]-3,7-dimethylnona-2,6-dienyl]indol-1-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 101253754 |
| Molecular Formula | C30H45NO2Si |
| Molecular Weight | 479.78 g/mol |
| Exact Mass | 479.32 |
| IUPAC Name | tert-butyl-[3-[(2E,6E)-9-[(2S,3S)-3-ethenyl-3-methyloxiran-2-yl]-3,7-dimethylnona-2,6-dienyl]indol-1-yl]oxy-dimethylsilane |
| SMILES | C=C[C@]1(C)O[C@H]1CC/C(C)=C/CC/C(C)=C/Cc1cn(O[Si](C)(C)C(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C30H45NO2Si/c1-10-30(7)28(32-30)21-19-24(3)15-13-14-23(2)18-20-25-22-31(27-17-12-11-16-26(25)27)33-34(8,9)29(4,5)6/h10-12,15-18,22,28H,1,13-14,19-21H2,2-9H3/b23-18+,24-15+/t28-,30-/m0/s1 |
| InChIKey | BTBFGZHJTGFYIZ-PSHUDLNNSA-N |
| XLogP | 8.41 |
| TPSA | 26.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.78 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|